PRODUCT Properties
| Melting point: | 140-1420C |
| alpha | D20 -1042° (c = 1 in alc) |
| Boiling point: | 357.82°C (rough estimate) |
| Density | 1.30±0.1 g/cm3 (20 ºC 760 Torr) |
| refractive index | 1.5300 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMSO: ≥25mg/mL |
| form | powder |
| pka | 8.29±0.20(Predicted) |
| color | yellow |
| optical activity | [α]/D -980 to -1015 (C=1, MeOH) |
| InChI | InChI=1S/C13H15NO2/c15-12-7-9-4-5-10-8-13(9,16-12)11-3-1-2-6-14(10)11/h4-5,7,10-11H,1-3,6,8H2/t10-,11-,13+/m1/s1 |
| InChIKey | SWZMSZQQJRKFBP-WZRBSPASSA-N |
| SMILES | N12CCCC[C@]1([H])[C@]13C[C@@]2([H])C=CC1=CC(=O)O3 |
Description and Uses
A constituent of the leaves of Securinega suffructicosa Rehd., the base also occurs in Phyllanthus disco ides. It is obtained as yellow crystals and is strongly laevorotatory having [α]20D - 1106°(CHC13), [α]30D - 1106°(CHC13) and[α]20D - 1042° (c 1.0, EtOH). The alkaloid yields a crystalline methiodide, m.p. 235-6°C.
Extracted from leaves and roots of Securinega suffruticosa Rehder. The most widely studied of these alkaloids, Securinine, is a specific GABA receptor antagonist and has been found to have significant in vivo CNS activity.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310-P405-P501 |
| Hazard Codes | T,Xn |
| Risk Statements | 23/24/25-22 |
| Safety Statements | 36/37/39-45 |
| WGK Germany | 3 |
| RTECS | VS4115000 |



