BD0682032
5-Methylcyclohexane-1,3-dione , 98% , 4341-24-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB45.60 | In Stock |
|
| 5g | RMB152.00 | In Stock |
|
| 25g | RMB583.20 | In Stock |
|
| 100g | RMB2052.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 126-130 °C(lit.) |
| Boiling point: | 194.28°C (rough estimate) |
| Density | 1.0579 (rough estimate) |
| refractive index | 1.4660 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform, Methanol |
| form | Solid |
| pka | 5.29±0.20(Predicted) |
| color | Tan to Light Brown |
| BRN | 1099692 |
| InChI | InChI=1S/C7H10O2/c1-5-2-6(8)4-7(9)3-5/h5H,2-4H2,1H3 |
| InChIKey | DMIIMPQQPXUKOO-UHFFFAOYSA-N |
| SMILES | C1(=O)CC(C)CC(=O)C1 |
| CAS DataBase Reference | 4341-24-6(CAS DataBase Reference) |
Description and Uses
5-Methyl-1,3-cyclohexanedione has been used in the synthesis of:
- racemic (±)-fawcettimine
- 3,6-dimethyl-2-phenylsulfanyl-3,5,6,7-tetrahydro-2H-benzofuran-4-one
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10 |
| Hazard Note | Irritant |
| HS Code | 29142990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



![5-[3,4-(Methylenedioxy)phenyl]-1,3-cyclohexanedione](https://img.chemicalbook.com/CAS/GIF/55579-76-5.gif)


