BD0712032
6-Chloro-4,5-diaminopyrimidine , 97% , 4316-98-7
CAS NO.：4316-98-7
Empirical Formula: C4H5ClN4
Molecular Weight: 144.56
MDL number: MFCD00023270
EINECS: 224-341-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB44.00 | In Stock |
|
| 1g | RMB92.80 | In Stock |
|
| 5g | RMB449.60 | In Stock |
|
| 10g | RMB841.60 | In Stock |
|
| 25g | RMB1848.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 252 °C (decomp) |
| Boiling point: | 336.7±37.0 °C(Predicted) |
| Density | 1.565 |
| Flash point: | 157℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | DMSO (Sparingly), Methanol (Slightly) |
| form | powder to crystal |
| pka | 2.39±0.10(Predicted) |
| color | White to Amber to Dark green |
| λmax | 305nm(lit.) |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C4H5ClN4/c5-3-2(6)4(7)9-1-8-3/h1H,6H2,(H2,7,8,9) |
| InChIKey | VNSFICAUILKARD-UHFFFAOYSA-N |
| SMILES | C1=NC(Cl)=C(N)C(N)=N1 |
| CAS DataBase Reference | 4316-98-7 |
| EPA Substance Registry System | 4,5-Pyrimidinediamine, 6-chloro- (4316-98-7) |
Description and Uses
4-Amino-6-chloropyrimidin-5-ylamine is a chlorinated diaminopyrimidine used in the preparation of various bioactive choloropurine derivatives.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| HS Code | 29335990 |
