BD0712248
(2-Bromo-4,5-dimethoxyphenyl)methanol , 95+% , 54370-00-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB114.40 | In Stock |
|
| 1g | RMB308.00 | In Stock |
|
| 5g | RMB1076.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 95-100 °C |
| Boiling point: | 326.7±37.0 °C(Predicted) |
| Density | 1.475±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 13.77±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to pink-purple |
| InChI | 1S/C9H11BrO3/c1-12-8-3-6(5-11)7(10)4-9(8)13-2/h3-4,11H,5H2,1-2H3 |
| InChIKey | SDZSRNYOXRHPHZ-UHFFFAOYSA-N |
| SMILES | OCC(C=C(OC)C(OC)=C1)=C1Br |
Description and Uses
2-Bromo-4,5-dimethoxybenzyl Alcohol is an intermediate compound used for the synthetic preparation of pharmaceutical goods. 2-Bromo-4,5-dimethoxybenzyl Alcohol have been used in the synthesis of roten oids.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P233-P260-P261-P264-P271-P280-P302+P352-P304-P304+P340-P305+P351+P338-P312-P321-P332+P313-P337+P313-P340-P362-P403-P403+P233-P405-P501 |
| target organs | Respiratory system |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 37/39-26 |
| WGK Germany | WGK 3 |
| HS Code | 29094980 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





![7-Bromo-2,3-dihydrobenzo[b][1,4]dioxine-6-carboxylicacid](https://img.chemicalbook.com/CAS/GIF/59820-91-6.gif)
![Methyl4-bromo-7-methoxybenzo[d][1,3]dioxole-5-carboxylate](https://img.chemicalbook.com/CAS/GIF/81474-46-6.gif)