PRODUCT Properties
| Melting point: | 90-92℃ |
| Boiling point: | 324.9±25.0 °C(Predicted) |
| Density | 1.546 |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | Chloroform (Slightly) |
| pka | 7.56±0.26(Predicted) |
| form | Solid |
| color | White to Off-White |
| Stability: | Hygroscopic, Moisture Sensitive |
| InChI | InChI=1S/C6H5ClO3S/c7-11(9,10)6-3-1-5(8)2-4-6/h1-4,8H |
| InChIKey | XKQZGGLHJYTXJA-UHFFFAOYSA-N |
| SMILES | C1(S(Cl)(=O)=O)=CC=C(O)C=C1 |
Description and Uses
4-Hydroxybenzenesulfonyl Chloride is useful for the preparation of amino acid derivatives with anticancer activity.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H290 |
| Precautionary statements | P260-P280-P303+P361+P353-P301+P330+P331-P304+P340+P310-P305+P351+P338+P310 |
| HS Code | 2908990000 |
