BD0721253
2-(1-Hydroxy-3-methylbutylidene)-5,5-dimethylcyclohexane-1,3-dione , 97% , 172611-72-2
Synonym(s):
2-Isovaleryldimedone;5,5-Dimethyl-2-(3-methylbutyryl)-1,3-cyclohexanedione;Ddiv
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB52.80 | In Stock |
|
| 1g | RMB158.40 | In Stock |
|
| 5g | RMB648.00 | In Stock |
|
| 25g | RMB1943.20 | In Stock |
|
| 100g | RMB5968.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 330.2±42.0 °C(Predicted) |
| Density | 1.027 g/mL at 20 °C(lit.) |
| refractive index | n |
| storage temp. | Store at room temperature |
| pka | 4.50±1.00(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| BRN | 3275155 |
| InChI | InChI=1S/C13H20O3/c1-8(2)5-9(14)12-10(15)6-13(3,4)7-11(12)16/h8,14H,5-7H2,1-4H3 |
| InChIKey | RIEWTRDZPSOAHC-UHFFFAOYSA-N |
| SMILES | C1(=O)CC(C)(C)CC(=O)/C/1=C(/O)\CC(C)C |
Description and Uses
2-(3-Methylbutyryl)-5,5-dimethyl-1,3-cyclohexandione is a crucial compound that could be used as a pharmaceutical intermediate in pharmaceutical synthesis and scientific research.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 2914.29.5000 |
