BD0724232
(R)-2,3-Dihydro-1H-inden-1-amine hydrochloride , 95% , 10305-73-4
CAS NO.：10305-73-4
Empirical Formula: C9H11N.HCl
Molecular Weight: 169.65
MDL number: MFCD11100854
EINECS: 692-843-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB57.60 | In Stock |
|
| 5g | RMB214.40 | In Stock |
|
| 10g | RMB381.60 | In Stock |
|
| 25g | RMB800.80 | In Stock |
|
| 100g | RMB3052.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 232-234°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Sparingly) |
| form | Solid |
| color | White to Off-White |
| optical activity | Consistent with structure |
| Stability: | Hygroscopic |
| InChI | InChI=1/C9H11N.ClH/c10-9-6-5-7-3-1-2-4-8(7)9;/h1-4,9H,5-6,10H2;1H/t9-;/s3 |
| InChIKey | RHAAGWRBIVCBSY-OVMXBOEKNA-N |
| SMILES | N[C@@H]1CCC2C=CC=CC1=2.Cl |&1:1,r| |
Description and Uses
An intermediate of N-[1-(R)-indanyl]adenosine as drug
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2904200090 |
