BD0737348
(2-(1,3-Dioxan-2-yl)ethyl)triphenylphosphoniumbromide , 98% , 69891-92-5
CAS NO.：69891-92-5
Empirical Formula: C24H26BrO2P
Molecular Weight: 457.35
MDL number: MFCD00012000
EINECS: 274-189-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB48.00 | In Stock |
|
| 5g | RMB165.60 | In Stock |
|
| 25g | RMB577.60 | In Stock |
|
| 100g | RMB1904.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 193-195 °C (lit.) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| Water Solubility | Soluble in water |
| form | solid |
| color | White to Light yellow |
| Sensitive | Moisture Sensitive |
| BRN | 4117571 |
| InChI | InChI=1S/C24H26O2P.BrH/c1-4-11-21(12-5-1)27(22-13-6-2-7-14-22,23-15-8-3-9-16-23)20-17-24-25-18-10-19-26-24;/h1-9,11-16,24H,10,17-20H2;1H/q+1;/p-1 |
| InChIKey | XETDBHNHTOJWPZ-UHFFFAOYSA-M |
| SMILES | [P+](C1C=CC=CC=1)(C1C=CC=CC=1)(C1C=CC=CC=1)CCC1OCCCO1.[Br-] |
| CAS DataBase Reference | 69891-92-5(CAS DataBase Reference) |
Description and Uses
2-(1,3-Dioxan-2-yl)ethyltriphenylphosphonium bromide can be used:
- As a three-carbon homologating agent used to prepare α,β- or β,γ- unsaturated compounds.
- In the olefination of methyl 5-oxopentanoate to yield methyl 7-(1,3-dioxan2-yl)hept-(5Z)-enoate.
- As a cathode interfacial layer material in polymer solar cells.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 2931599090 |
