BD0739353
1-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3-oxo-7,10,13,16,19,22-hexaoxa-4-azapentacosan-25-oicacid , 95% , 1334177-79-5
CAS NO.:1334177-79-5
Empirical Formula: C22H36N2O11
Molecular Weight: 504.53
MDL number: MFCD21363276
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB453.60 | In Stock |
|
| 250mg | RMB682.40 | In Stock |
|
| 1g | RMB1708.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 702.5±60.0 °C(Predicted) |
| Density | 1.241±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| pka | 4.28±0.10(Predicted) |
| form | Solid |
| color | Off-white to gray |
| InChI | InChI=1S/C22H36N2O11/c25-19(3-6-24-20(26)1-2-21(24)27)23-5-8-31-10-12-33-14-16-35-18-17-34-15-13-32-11-9-30-7-4-22(28)29/h1-2H,3-18H2,(H,23,25)(H,28,29) |
| InChIKey | WKTGEZMXNNBFEZ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCOCCOCCOCCOCCOCCOCCNC(=O)CCN1C(=O)C=CC1=O |
Description and Uses
Mal-amido-PEG6-acid is a PEG linker containing a maleimide group and a terminal carboxylic acid. The hydrophilic PEG spacer increases solubility in aqueous media. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The maleimide group will react with a thiol group to form a covalent bond, enabling the connection of biomolecule with a thiol.
Mal-amido-PEG6-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |







