BD0755232
Phenyl(pyridin-3-yl)methanone , 98% , 5424-19-1
Synonym(s):
3-Benzoylpyridine
CAS NO.:5424-19-1
Empirical Formula: C12H9NO
Molecular Weight: 183.21
MDL number: MFCD00006394
EINECS: 226-561-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB43.20 | In Stock |
|
| 5g | RMB136.80 | In Stock |
|
| 25g | RMB626.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 36-40 °C(lit.) |
| Boiling point: | 307 °C(lit.) |
| Density | 1.1261 (rough estimate) |
| refractive index | 1.5880 (estimate) |
| Flash point: | 302 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| pka | 3.23±0.10(Predicted) |
| form | Crystalline Solid |
| color | White to light yellow |
| BRN | 120234 |
| InChI | InChI=1S/C12H9NO/c14-12(10-5-2-1-3-6-10)11-7-4-8-13-9-11/h1-9H |
| InChIKey | RYMBAPVTUHZCNF-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC=C1)(C1=CC=CN=C1)=O |
| LogP | 1.880 |
| CAS DataBase Reference | 5424-19-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Phenyl 3-pyridyl ketone(5424-19-1) |
Description and Uses
3-Benzoylpyridine is a monopyridyl ketone ligand that binds cobalt(II) and nickel(II) through its nitrogen atom, giving complexes of the MX2L4, MX2L2 and MX2L4 types, and it also forms the polymeric mixed-ligand complex Cu(3-benzoylpyridine)2(N3)2 with copper(II) azide[1-2].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | OB6401000 |
| HS Code | 2933 39 99 |
| Storage Class | 11 - Combustible Solids |






