BD0759045
3-Amino-3-cyclopropylpropanoicacid , 97% , 331633-72-8
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB102.40 | In Stock |
|
| 250mg | RMB172.00 | In Stock |
|
| 1g | RMB430.40 | In Stock |
|
| 5g | RMB1544.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 265.073±23.00 °C(Press: 760.00 Torr)(predicted) |
| Density | 1.246±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) |
| storage temp. | 2-8°C(protect from light) |
| pka | 3.635±0.12(predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C6H11NO2/c7-5(3-6(8)9)4-1-2-4/h4-5H,1-3,7H2,(H,8,9) |
| InChIKey | IHWFMMMLMIDKCB-UHFFFAOYSA-N |
| SMILES | C1(CC1)C(N)CC(=O)O |
Description and Uses
3-Amino-3-cyclopropylpropanoic acid is a useful research chemical.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |






