BD0759832
1-Oxo-2,3-dihydro-1H-indene-4-carbonitrile , 97% , 60899-34-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB59.20 | In Stock |
|
| 1g | RMB151.20 | In Stock |
|
| 5g | RMB465.60 | In Stock |
|
| 10g | RMB830.40 | In Stock |
|
| 25g | RMB2027.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 116-117 °C |
| Boiling point: | 330.1±31.0 °C(Predicted) |
| Density | 1.23±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | solid |
| color | Off-white |
| InChI | InChI=1S/C10H7NO/c11-6-7-2-1-3-9-8(7)4-5-10(9)12/h1-3H,4-5H2 |
| InChIKey | SCTBWJINDJVNDM-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C(C#N)=CC=C2)CC1 |
Description and Uses
2,3-Dihydro-1-oxo-1h-indene-4-carbonitrile is a reagent in the preparation and anticonvulsant activity of imidazoindenopyrazinone carboxylic acid derivatives as AMPA antagonists.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2926907090 |





![8-Acetyl-6-(benzyloxy)-2H-benzo[b][1,4]oxazin-3(4H)-one](https://img.chemicalbook.com/CAS/GIF/869478-09-1.gif)

![(R)-6-(Benzyloxy)-8-(oxiran-2-yl)-2H-benzo[b][1,4]oxazin-3(4H)-one](https://img.chemicalbook.com/CAS/20180703/GIF/869478-12-6.gif)