BD9854031
8-Acetyl-6-(benzyloxy)-2H-benzo[b][1,4]oxazin-3(4H)-one , 97% , 869478-09-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB121.60 | In Stock |
|
| 250mg | RMB217.60 | In Stock |
|
| 1g | RMB587.20 | In Stock |
|
| 5g | RMB2055.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 517.2±50.0 °C(Predicted) |
| Density | 1.259±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform, DCM, Methanol |
| pka | 11.84±0.20(Predicted) |
| form | Solid |
| color | Beige |
| InChI | InChI=1S/C17H15NO4/c1-11(19)14-7-13(21-9-12-5-3-2-4-6-12)8-15-17(14)22-10-16(20)18-15/h2-8H,9-10H2,1H3,(H,18,20) |
| InChIKey | URTYAHMRXXVHKS-UHFFFAOYSA-N |
| SMILES | O1C2=C(C(C)=O)C=C(OCC3=CC=CC=C3)C=C2NC(=O)C1 |
Description and Uses
8-Acetyl-6-benzyloxy-4H-benzo[1,4]oxazin-3-one is an intermediate in the synthesis of Olodaterol (O262000), a novel inhaled β2-adrenoceptor agonist with a 24h bronchodilatory efficacy.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| HS Code | 2914390090 |

![8-Acetyl-6-(benzyloxy)-2H-benzo[b][1,4]oxazin-3(4H)-one](https://img.chemicalbook.com/CAS/GIF/869478-09-1.gif)





![(R)-6-(Benzyloxy)-8-(oxiran-2-yl)-2H-benzo[b][1,4]oxazin-3(4H)-one](https://img.chemicalbook.com/CAS/20180703/GIF/869478-12-6.gif)