BD0777745
Ethyl2-(3-cyano-4-hydroxyphenyl)-4-methylthiazole-5-carboxylate , 97% , 161798-02-3
CAS NO.:161798-02-3
Empirical Formula: C14H12N2O3S
Molecular Weight: 288.32
MDL number: MFCD15144699
EINECS: 1308068-626-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB49.60 | In Stock |
|
| 5g | RMB148.00 | In Stock |
|
| 10g | RMB250.40 | In Stock |
|
| 25g | RMB504.80 | In Stock |
|
| 100g | RMB1524.00 | In Stock |
|
| 500g | RMB4420.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 208 - 210oC |
| Boiling point: | 475.3±55.0 °C(Predicted) |
| Density | 1.38 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 5.80±0.20(Predicted) |
| form | Solid |
| color | Off-White |
| InChI | InChI=1S/C14H12N2O3S/c1-3-19-14(18)12-8(2)16-13(20-12)9-4-5-11(17)10(6-9)7-15/h4-6,17H,3H2,1-2H3 |
| InChIKey | WTMZFYPEMMFHPR-UHFFFAOYSA-N |
| SMILES | S1C(C(OCC)=O)=C(C)N=C1C1=CC=C(O)C(C#N)=C1 |
Description and Uses
2-(3-Cyano-4-hydroxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic Acid Ethyl Ester, can be used for the synthesis of Febuxostat (F229000), an antipodagrics.






