BD0781753
tert-Butyl4-(((methylsulfonyl)oxy)methyl)piperidine-1-carboxylate , 95% , 161975-39-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB36.80 | In Stock |
|
| 1g | RMB87.20 | In Stock |
|
| 5g | RMB272.00 | In Stock |
|
| 10g | RMB473.60 | In Stock |
|
| 25g | RMB1151.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 73-76°C |
| Boiling point: | 418.8±18.0 °C(Predicted) |
| Density | 1.175±0.06 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| pka | -1.96±0.40(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C12H23NO5S/c1-12(2,3)18-11(14)13-7-5-10(6-8-13)9-17-19(4,15)16/h10H,5-9H2,1-4H3 |
| InChIKey | RXNQBVRCZIYUJK-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCC(COS(C)(=O)=O)CC1 |
Description and Uses
1-Boc-4-methanesulfonyloxymethyl-piperidine can be used to synthesize antitumor, central nervous system drugs, GPCR ligands, and kinase inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| HazardClass | IRRITANT |
| REACH Registrations | Inactive |







