BD3193448
tert-Butyl4-methylpiperidine-1-carboxylate , 97% , 123387-50-8
CAS NO.：123387-50-8
Empirical Formula: C11H21NO2
Molecular Weight: 199.29
MDL number: MFCD04114947
EINECS: 604-604-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB93.60 | In Stock |
|
| 1g | RMB252.80 | In Stock |
|
| 5g | RMB884.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 255.0±9.0 °C(Predicted) |
| Density | 0.973±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Dichloromethane, Ether, Ethyl Acetate, Hexanes |
| form | Oil |
| pka | -1.24±0.40(Predicted) |
| color | Yellow |
| InChI | InChI=1S/C11H21NO2/c1-9-5-7-12(8-6-9)10(13)14-11(2,3)4/h9H,5-8H2,1-4H3 |
| InChIKey | OXSSNJRGXRJNPX-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCC(C)CC1 |
Description and Uses
1,4-Disubstituted piperidine derivative, used in the preparation of thrombin inhibitors.
Safety
| Symbol(GHS) |   GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H227-H301-H315-H319-H335-H410 |
| Precautionary statements | P261-P273-P301+P310-P305+P351+P338 |
| HS Code | 2933399990 |
