BD0784453
5-(4-Chlorophenyl)-1H-pyrazol-3-amine , 98% , 78583-81-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB84.00 | In Stock |
|
| 250mg | RMB127.20 | In Stock |
|
| 1g | RMB343.20 | In Stock |
|
| 5g | RMB1062.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 172-176 °C(lit.) |
| Boiling point: | 463.8±35.0 °C(Predicted) |
| Density | 1.378±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, protect from light |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 14.08±0.10(Predicted) |
| color | White to Almost white |
| InChI | 1S/C9H8ClN3/c10-7-3-1-6(2-4-7)8-5-9(11)13-12-8/h1-5H,(H3,11,12,13) |
| InChIKey | XQPBZIITFQHIDI-UHFFFAOYSA-N |
| SMILES | Nc1cc(n[nH]1)-c2ccc(Cl)cc2 |
| CAS DataBase Reference | 78583-81-0(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933199090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |




![1-[2-(4-CHLOROPHENYL)-7-METHYLPYRAZOLO[1,5-A]PYRIMIDIN-6-YL]ETHAN-1-ONE](https://img.chemicalbook.com/CAS/GIF/175201-63-5.gif)


