BD0798732
4-(Trifluoromethyl)nicotinamide , 98% , 158062-71-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB33.60 | In Stock |
|
| 1g | RMB89.60 | In Stock |
|
| 5g | RMB434.40 | In Stock |
|
| 10g | RMB806.40 | In Stock |
|
| 25g | RMB1716.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165°C |
| Boiling point: | 292.0±40.0 °C(Predicted) |
| Density | 1.409±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 14.29±0.50(Predicted) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C7H5F3N2O/c8-7(9,10)5-1-2-12-3-4(5)6(11)13/h1-3H,(H2,11,13) |
| InChIKey | JUIWZYBJXUPIKF-UHFFFAOYSA-N |
| SMILES | C1=NC=CC(C(F)(F)F)=C1C(N)=O |
| CAS DataBase Reference | 158062-71-6(CAS DataBase Reference) |
| EPA Substance Registry System | 3-Pyridinecarboxamide, 4-(trifluoromethyl)- (158062-71-6) |
Description and Uses
4-(Trifluoromethyl)nicotinamide (TFNA-AM) is a metabolite of Flonicamid (F405710); a novel insecticide with rapid inhibitory effect against aphid feeding.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Warning |
| Hazard statements | H341 |
| Precautionary statements | P501-P202-P201-P280-P308+P313-P405 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |





