BD0807653
2-Hydroxy-3,5-diisopropylbenzoicacid , 95% , 2215-21-6
Synonym(s):
3,5-Diisopropylsalicylic acid
CAS NO.：2215-21-6
Empirical Formula: C13H18O3
Molecular Weight: 222.28
MDL number: MFCD00008884
EINECS: 218-677-8
| Pack Size | Price | Stock | Quantity |
| 5g | RMB230.40 | In Stock |
|
| 25g | RMB563.20 | In Stock |
|
| 100g | RMB1884.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 113-115 °C (lit.) |
| Boiling point: | 303.46°C (rough estimate) |
| Density | 1.1205 (rough estimate) |
| refractive index | 1.4740 (estimate) |
| storage temp. | 4°C |
| solubility | Soluble in organic solvents. |
| form | Solid |
| pka | 3.21±0.14(Predicted) |
| color | White to Off-White |
| BRN | 2505176 |
| InChI | 1S/C13H18O3/c1-7(2)9-5-10(8(3)4)12(14)11(6-9)13(15)16/h5-8,14H,1-4H3,(H,15,16) |
| InChIKey | XUFUYOGWFZSHGE-UHFFFAOYSA-N |
| SMILES | CC(C)c1cc(C(C)C)c(O)c(c1)C(O)=O |
| CAS DataBase Reference | 2215-21-6(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 2-hydroxy-3,5-bis(1-methylethyl)- (2215-21-6) |
Description and Uses
3,5-Diisopropyl-2-hydroxybenzoic acid was used as starting reagent in the synthesis of Zn(II) and Cd(II) carboxylate complexes.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37 |
| Safety Statements | 22-26-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29182900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 STOT SE 3 |
