BD0821545
Terconazole , 97% , 67915-31-5
Synonym(s):
(+-)-1-{4-[cis-2-(2,4-Dichlorophenyl)-2-(1H-1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-ylmethoxy]phenyl}-4-isopropylpiperazine;Terconazole;Triaconazole
CAS NO.:67915-31-5
Empirical Formula: C26H31Cl2N5O3
Molecular Weight: 532.46
MDL number: MFCD05662369
EINECS: 267-751-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB244.00 | In Stock |
|
| 250mg | RMB366.40 | In Stock |
|
| 1g | RMB1049.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 126.3°C |
| Boiling point: | 681.8±65.0 °C(Predicted) |
| Density | 1.35±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO: soluble1mg/mL |
| pka | 8.33±0.10(Predicted) |
| form | powder |
| color | white |
| InChIKey | BLSQLHNBWJLIBQ-GRHWAJSLNA-N |
| SMILES | N1(C2=CC=C(OC[C@H]3CO[C@@](C4=CC=C(Cl)C=C4Cl)(CN4C=NC=N4)O3)C=C2)CCN(C(C)C)CC1 |&1:7,10,r| |
| CAS DataBase Reference | 67915-31-5(CAS DataBase Reference) |
Description and Uses
Terconazole is an antifungal agent somewhat more potent than clotrimazole and useful in the topical treatment of vaginal dermatophytosis and candidiasis.
Terazol (Ortho-McNeil).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H413 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-53 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| RTECS | TL3564600 |
| HS Code | 2934990002 |






