BD0822445
(R)-1-(p-Tolyl)ethanamine , 95% , 4187-38-6
CAS NO.:4187-38-6
Empirical Formula: C9H13N
Molecular Weight: 135.21
MDL number: MFCD00145202
EINECS: 624-182-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB63.20 | In Stock |
|
| 250mg | RMB85.60 | In Stock |
|
| 1g | RMB116.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <-20°C |
| alpha | 37 º (NEAT) |
| Boiling point: | 205 °C (lit.) |
| Density | 0.919 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 180 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 9.20±0.10(Predicted) |
| form | liquid |
| Specific Gravity | 0.919 |
| Appearance | Colorless to light yellow Liquid |
| optical activity | [α]20/D +37°, neat |
| Sensitive | Air Sensitive |
| BRN | 3195425 |
| InChI | InChI=1/C9H13N/c1-7-3-5-9(6-4-7)8(2)10/h3-6,8H,10H2,1-2H3/t8-/s3 |
| InChIKey | UZDDXUMOXKDXNE-SBYBRXNCNA-N |
| SMILES | [C@@H](C1C=CC(C)=CC=1)(N)C |&1:0,r| |
| CAS DataBase Reference | 4187-38-6(CAS DataBase Reference) |
Description and Uses
(R)-(+)-α,4-Dimethylbenzylamine can be used as a chiral salt of keto acid, employed in the solid-state photolysis studies of α-mesitylacetophenone derivatives.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302+H312+H332-H314 |
| Precautionary statements | P261-P280-P301+P312-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | 20/21/22-34 |
| Safety Statements | 16-26-27-36/37/39-45 |
| RIDADR | UN 2619 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 2921490090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Skin Corr. 1B |





