BD0830032
                    (R)-3-(4-Bromo-3-fluorophenyl)-5-(hydroxymethyl)oxazolidin-2-one , 97% , 444335-16-4
CAS NO.:444335-16-4
Empirical Formula: C10H9BrFNO3
Molecular Weight: 290.09
MDL number: MFCD08166353
EINECS: 1592732-453-0
| Pack Size | Price | Stock | Quantity | 
| 250mg | RMB34.40 | In Stock | 
                                                 | 
                                        
| 1g | RMB71.20 | In Stock | 
                                                 | 
                                        
| 5g | RMB148.80 | In Stock | 
                                                 | 
                                        
| 10g | RMB288.80 | In Stock | 
                                                 | 
                                        
| 25g | RMB702.40 | In Stock | 
                                                 | 
                                        
| 100g | RMB2426.40 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Boiling point: | 401.6±35.0 °C(Predicted) | 
                                    
| Density | 1.701±0.06 g/cm3(Predicted) | 
                                    
| storage temp. | 2-8°C | 
                                    
| pka | 14.05±0.10(Predicted) | 
                                    
| Appearance | White to light yellow Solid | 
                                    
| optical activity | -36° (C=0.01 g/ml, DMSO) | 
                                    
| InChI | InChI=1S/C10H9BrFNO3/c11-8-2-1-6(3-9(8)12)13-4-7(5-14)16-10(13)15/h1-3,7,14H,4-5H2/t7-/m1/s1 | 
                                    
| InChIKey | UGBKYDASQNOIHP-SSDOTTSWSA-N | 
                                    
| SMILES | O1[C@@H](CO)CN(C2=CC=C(Br)C(F)=C2)C1=O | 
                                    
Description and Uses
(5R)-3-(4-Bromo-3-fluorophenyl)-5-(hydroxymethyl)-2-oxazolidinone is an oxazolidinone derivative and often used for chiral synthesis. Oxazolidinone are also used as antimicrobial agents.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H302-H315-H319-H335 | 
| Precautionary statements | P261-P305+P351+P338 | 






