BD0831453
Thiazolidine-4-carboxylicacid , 98% , 444-27-9
CAS NO.:444-27-9
Empirical Formula: C4H7NO2S
Molecular Weight: 133.17
MDL number: MFCD00128958
EINECS: 207-146-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB58.40 | In Stock |
|
| 1g | RMB141.60 | In Stock |
|
| 5g | RMB540.00 | In Stock |
|
| 10g | RMB915.20 | In Stock |
|
| 25g | RMB2034.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 196.5°C |
| Boiling point: | 350.3±37.0 °C(Predicted) |
| Density | 1.226 (estimate) |
| refractive index | 1.5480 (estimate) |
| storage temp. | Room Temperature |
| solubility | DMSO (Slightly), Water (Slightly) |
| form | solid |
| pka | 2.09±0.20(Predicted) |
| color | White to off-white |
| Water Solubility | 29.3g/L(21 ºC) |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | InChI=1S/C4H7NO2S/c6-4(7)3-1-8-2-5-3/h3,5H,1-2H2,(H,6,7) |
| InChIKey | DZLNHFMRPBPULJ-UHFFFAOYSA-N |
| SMILES | S1CC(C(O)=O)NC1 |
| CAS DataBase Reference | 444-27-9(CAS DataBase Reference) |
| EPA Substance Registry System | 4-Thiazolidinecarboxylic acid (444-27-9) |
Description and Uses
Timonacic is a derivative of Proline (P756050), a cyclic nonessential amino acid. Timonacic is a research molecule of interest with potential antineoplastic activities by acting on the cell membrane of tumour cells and causing reverse transformation to normal cells.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P310+P330-P302+P352+P312-P304+P340+P312-P305+P351+P338-P332+P313-P337+P313-P403+P233-P405-P501 |
| RIDADR | 2811 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |





