BD0837832
(R)-(-)-5-Oxotetrahydrofuran-2-carboxylicacid , 95% , 53558-93-3
Synonym(s):
(R)-γ-Carboxy-γ-butyrolactone;(R)-5-Oxotetrahydro-2-furancarboxylic acid
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB38.40 | In Stock |
|
| 1g | RMB144.00 | In Stock |
|
| 5g | RMB375.20 | In Stock |
|
| 10g | RMB727.20 | In Stock |
|
| 25g | RMB1460.80 | In Stock |
|
| 100g | RMB5316.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 71-73 °C (lit.) |
| Boiling point: | 165-167 °C/0.3 mmHg (lit.) |
| alpha | -14°(D/20℃) (c=5, メタノール) |
| Density | 1.3985 (rough estimate) |
| refractive index | 1.5800 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 3.11±0.20(Predicted) |
| form | solid |
| Appearance | White to light yellow Solid |
| optical activity | [α]20/D 14°, c = 5 in methanol |
| BRN | 1424499 |
| InChI | InChI=1S/C5H6O4/c6-4-2-1-3(9-4)5(7)8/h3H,1-2H2,(H,7,8)/t3-/m1/s1 |
| InChIKey | QVADRSWDTZDDGR-GSVOUGTGSA-N |
| SMILES | O1C(=O)CC[C@@H]1C(O)=O |
| CAS DataBase Reference | 53558-93-3(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Furancarboxylic acid, tetrahydro-5-oxo-, (2R)- (53558-93-3) |
Description and Uses
(R)-5-Oxotetrahydrofuran-2-carboxylic Acid is an intermediate used to synthesize 2'',3''-dideoxy-4''-selenonucleosides as potential antiviral agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29321900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



![(1R)-4,7,7-Trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylicacid](https://img.chemicalbook.com/CAS/GIF/67111-66-4.gif)


