BD0839132
3-(Furan-3-yl)acrylic acid , 98+% , 39244-10-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB1160.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 155-158 °C(lit.) |
| Boiling point: | 261.4±15.0 °C(Predicted) |
| Density | 1.280±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform, Methanol |
| form | Solid |
| pka | 4.20±0.10(Predicted) |
| color | Pale Yellow |
| Water Solubility | Sparingly soluble in water (0.56 g/L at 25°C). |
| BRN | 1306450 |
| InChI | InChI=1S/C7H6O3/c8-7(9)2-1-6-3-4-10-5-6/h1-5H,(H,8,9) |
| InChIKey | JHAPZUDWRRBZHZ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C=CC1C=COC=1 |
| CAS DataBase Reference | 39244-10-5(CAS DataBase Reference) |
Description and Uses
3-(3-Furyl)acrylic acid is used as an intermediate in chemical research and pharmaceuticals.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 2932990090 |
