BD0849548
Tetrabutylammoniumbenzoate , 98% , 18819-89-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB148.00 | In Stock |
|
| 250mg | RMB221.60 | In Stock |
|
| 1g | RMB553.60 | In Stock |
|
| 5g | RMB1940.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 64-67 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | acetonitrile: 0.1 g/mL, clear, colorless |
| form | crystals |
| BRN | 4070140 |
| InChI | 1S/C16H36N.C7H6O2/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;8-7(9)6-4-2-1-3-5-6/h5-16H2,1-4H3;1-5H,(H,8,9)/q+1;/p-1 |
| InChIKey | WGYONVRJGWHMKV-UHFFFAOYSA-M |
| SMILES | [O-]C(=O)c1ccccc1.CCCC[N+](CCCC)(CCCC)CCCC |
Description and Uses
Tetrabutylammonium benzoate may be used as an analytical reagent for the electrochemical generation of hydrogen from acetic acid using a molecular molybdenum-oxo catalyst.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 3-10 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
