A7717912
Tetrabutylammonium acetate , 97%, 1: 2 (acetic acid) , 10534-59-5
Synonym(s):
TBAAc
CAS NO.:10534-59-5
Empirical Formula: C18H39NO2
Molecular Weight: 301.51
MDL number: MFCD00043208
EINECS: 234-101-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB52.00 | In Stock |
|
| 100G | RMB153.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 95-98 °C (lit.) |
| Boiling point: | 100 °C |
| Density | 0.99 g/mL at 25 °C |
| refractive index | n |
| Flash point: | 100°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | acetonitrile: 0.1 g/mL, clear, colorless to very faint brown |
| form | Crystalline |
| color | White |
| Sensitive | Hygroscopic |
| BRN | 3599376 |
| Stability: | Hygroscopic |
| InChI | 1S/C16H36N.C2H4O2/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-2(3)4/h5-16H2,1-4H3;1H3,(H,3,4)/q+1;/p-1 |
| InChIKey | MCZDHTKJGDCTAE-UHFFFAOYSA-M |
| SMILES | CC([O-])=O.CCCC[N+](CCCC)(CCCC)CCCC |
| CAS DataBase Reference | 10534-59-5(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Butanaminium, N,N,N-tributyl-, acetate (10534-59-5) |
Description and Uses
Tetrabutylammonium Acetate acts as a catalyst in organic syntheses of anion sensors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| F | 3-10 |
| TSCA | TSCA listed |
| HS Code | 29239000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




