BD0850932
Boc-D-3-Abu-OH , 95% , 159991-23-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB28.80 | In Stock |
|
| 10g | RMB46.40 | In Stock |
|
| 25g | RMB85.60 | In Stock |
|
| 100g | RMB301.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 104-107 °C |
| Boiling point: | 339.5±25.0 °C(Predicted) |
| Density | 1.101±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| pka | 4.43±0.10(Predicted) |
| Appearance | White to off-white Solid |
| optical activity | Consistent with structure |
| InChI | InChI=1S/C9H17NO4/c1-6(5-7(11)12)10-8(13)14-9(2,3)4/h6H,5H2,1-4H3,(H,10,13)(H,11,12)/t6-/m1/s1 |
| InChIKey | PYNDHEONPQYIAN-ZCFIWIBFSA-N |
| SMILES | C(O)(=O)C[C@H](NC(OC(C)(C)C)=O)C |
| CAS DataBase Reference | 159991-23-8(CAS DataBase Reference) |
Description and Uses
(R)-3-(tert-Butoxycarbonylamino)butanoic Acid is a non-proteinogenic amino acid that can be used to synthesize peptide analogs.
Safety
| Symbol(GHS) |   GHS07,GHS02 |
| Signal word | Warning |
| Hazard statements | H315-H319-H226 |
| Precautionary statements | P501-P240-P210-P233-P243-P241-P242-P264-P280-P370+P378-P337+P313-P305+P351+P338-P362+P364-P303+P361+P353-P332+P313-P403+P235 |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45 |
