BD0858653
2-Hydroxycarbazole , 95% , 86-79-3
Synonym(s):
2-Carbazolol
CAS NO.:86-79-3
Empirical Formula: C12H9NO
Molecular Weight: 183.21
MDL number: MFCD00004962
EINECS: 201-699-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB40.00 | In Stock |
|
| 1g | RMB98.40 | In Stock |
|
| 5g | RMB466.40 | In Stock |
|
| 25g | RMB2188.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 270-273 °C (lit.) |
| Boiling point: | 316.88°C (rough estimate) |
| Density | 1.1261 (rough estimate) |
| refractive index | 1.5880 (estimate) |
| storage temp. | 2-8°C, stored under nitrogen |
| form | solid |
| pka | 10.05±0.30(Predicted) |
| color | Grey |
| BRN | 135859 |
| InChI | 1S/C12H9NO/c14-8-5-6-10-9-3-1-2-4-11(9)13-12(10)7-8/h1-7,13-14H |
| InChIKey | GWPGDZPXOZATKL-UHFFFAOYSA-N |
| SMILES | Oc1ccc2c(c1)[nH]c3ccccc23 |
| CAS DataBase Reference | 86-79-3(CAS DataBase Reference) |
Description and Uses
Carbazol has been found possible to distinguish between heparin, heparin derivatives, and other polyuronides of connective tissue. A new modification of the carbazole analysis is useful for determination of d-mannuronic acid in heteropolysaccharides. 2-Hydroxycarbazole was used in the synthesis of isochromene fused carbazol, (4aS,13bR)-2,5,5-trimethyl-3,4,4a,5,8,13b-hexahydroisochromeno[3,4-b]carbazole.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,C,T,F |
| Risk Statements | 36/37/38-34 |
| Safety Statements | 26-36-37/39-45-36/37/39-27 |
| WGK Germany | 2 |
| RTECS | FE6355000 |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






