BD0860132
4-Hydroxy-6-methylnicotinic acid , 98% , 67367-33-3
CAS NO.:67367-33-3
Empirical Formula: C7H7NO3
Molecular Weight: 153.14
MDL number: MFCD04038153
EINECS: 675-033-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 10g | RMB33.60 | In Stock |
|
| 25g | RMB51.20 | In Stock |
|
| 100g | RMB151.20 | In Stock |
|
| 500g | RMB748.00 | In Stock |
|
| 1000g | RMB1378.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 263-265°C |
| Boiling point: | 481.1±45.0 °C(Predicted) |
| Density | 1.393 |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 0.26±0.10(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C7H7NO3/c1-4-2-6(9)5(3-8-4)7(10)11/h2-3H,1H3,(H,8,9)(H,10,11) |
| InChIKey | AOJLDZLRTUWFFY-UHFFFAOYSA-N |
| SMILES | C1=NC(C)=CC(O)=C1C(O)=O |
| CAS DataBase Reference | 67367-33-3(CAS DataBase Reference) |
Description and Uses
4-Hydroxy-6-methylnicotinic acid can be used to synthesize the isomeric lanthanide complex [Ln2(L)6(H2O)2]-2H2O [Ln = Ce (1), Ln = Nd (2), Ln = Sm (3), Ln = Pr (4)] (HL = 4-Hydroxy-6-Methylnicotinic Acid), which is intensively investigated for its crystal structure and properties.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| HS Code | 2933399990 |




