BD0863248
N,N-Dimethyl-2-(4-methylpiperazin-1-yl)ethanamine , 98% , 104-19-8
CAS NO.:104-19-8
Empirical Formula: C9H21N3
Molecular Weight: 171.28
MDL number: MFCD00059773
EINECS: 203-183-7
| Pack Size | Price | Stock | Quantity |
| 25g | RMB100.00 | In Stock |
|
| 100g | RMB187.20 | In Stock |
|
| 500g | RMB412.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 96 °C / 12mmHg |
| Density | 0,89 g/cm3 |
| vapor pressure | 28.6Pa at 25℃ |
| refractive index | 1.4630-1.4660 |
| Flash point: | 100°C(lit.) |
| Water Solubility | Completely miscible in water |
| pka | 9.50±0.28(Predicted) |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| InChI | InChI=1S/C9H21N3/c1-10(2)4-7-12-8-5-11(3)6-9-12/h4-9H2,1-3H3 |
| InChIKey | XFLSMWXCZBIXLV-UHFFFAOYSA-N |
| SMILES | N1(CCN(C)C)CCN(C)CC1 |
| LogP | -0.591 at 21℃ |
| CAS DataBase Reference | 104-19-8(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Piperazineethanamine, N,N,4-trimethyl- (104-19-8) |
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H302-H311-H314 |
| Precautionary statements | P260-P264-P270-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P405-P501 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 2922 |
| RTECS | TL6125000 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 2933599590 |
| REACH Registrations | Active |




![4-Iodo-N-[2-[4-(2-methoxyphenyl)-1-piperazinyl]ethyl]-N-(2-pyridyl)benzamide](https://img.chemicalbook.com/CAS/GIF/155204-23-2.gif)


