PRODUCT Properties
| Melting point: | 180-182° |
| Boiling point: | 520.2±60.0 °C(Predicted) |
| Density | 1.472±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO: slightly; Methanol: slightly |
| form | A solid |
| pka | 9.90±0.10(Predicted) |
| color | White to off-white |
| InChI | InChI=1S/C10H14N2O4S2/c11-18(15,16)10-5-3-9(4-6-10)12-7-1-2-8-17(12,13)14/h3-6H,1-2,7-8H2,(H2,11,15,16) |
| InChIKey | HMHVCUVYZFYAJI-UHFFFAOYSA-N |
| SMILES | C1(S(N)(=O)=O)=CC=C(N2CCCCS2(=O)=O)C=C1 |
Description and Uses
Sulthiame is a benzenesulfonamide derivative. Sulthiame acts as an inhibitor of the enzyme carbonic anhydrase. Sulthiame is used as an anticonvulsant in the treatment of benign and symptomatic focal epilepsy.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P305+P351+P338-P332+P313-P362+P364-P337+P313 |
