BD0868848
(2S,3S,4S)-2-Methyl-3,4-dihydro-2H-pyran-3,4-diyldiacetate , 95% , 34819-86-8
Synonym(s):
Di-O-acetyl-L -rhamnal
CAS NO.:34819-86-8
Empirical Formula: C10H14O5
Molecular Weight: 214.22
MDL number: MFCD00074970
EINECS: 252-228-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB230.40 | In Stock |
|
| 5g | RMB911.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 68-69 °C0.06 mm Hg(lit.) |
| Density | 1.116 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform, Dichloromethane |
| form | Viscous Liquid |
| color | Colorless to Yellow |
| optical activity | [α]/D 55°, c = 1 in chloroform |
| BRN | 84954 |
| InChI | 1S/C10H14O5/c1-6-10(15-8(3)12)9(4-5-13-6)14-7(2)11/h4-6,9-10H,1-3H3/t6-,9-,10-/m0/s1 |
| InChIKey | NDEGMKQAZZBNBB-JUWDTYFHSA-N |
| SMILES | C[C@@H]1OC=C[C@H](OC(C)=O)[C@H]1OC(C)=O |
| CAS DataBase Reference | 34819-86-8(CAS DataBase Reference) |
Description and Uses
A DNA-binding agent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29400090 |
| Storage Class | 10 - Combustible liquids |






