BD0870832
(S)-2-((tert-Butoxycarbonyl)amino)pent-4-enoic acid , 97% , 90600-20-7
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB28.80 | In Stock |
|
| 250mg | RMB69.60 | In Stock |
|
| 1g | RMB187.20 | In Stock |
|
| 5g | RMB623.20 | In Stock |
|
| 10g | RMB1100.80 | In Stock |
|
| 25g | RMB2303.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 355.52°C (rough estimate) |
| alpha | 10.5 º (c=1, methanol) |
| Density | 1.1835 (rough estimate) |
| refractive index | 1.4610 (estimate) |
| storage temp. | 2-8°C |
| solubility | Chloroform, Methanol |
| pka | 3.83±0.10(Predicted) |
| form | Viscous Liquid |
| color | Clear pale yellow |
| optical activity | Consistent with structure |
| InChI | InChI=1S/C10H17NO4/c1-5-6-7(8(12)13)11-9(14)15-10(2,3)4/h5,7H,1,6H2,2-4H3,(H,11,14)(H,12,13)/t7-/m0/s1 |
| InChIKey | BUPDPLXLAKNJMI-ZETCQYMHSA-N |
| SMILES | C(O)(=O)[C@@H](NC(OC(C)(C)C)=O)CC=C |
Description and Uses
(S)-N-Boc-allylglycine is a boc-protected allylglycine used in the preparation of arginine analogues including the natural amino acid enduracididine.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25 |
| HS Code | 29224985 |
