BD0872253
Ethyl2-(2-methyl-1H-indol-3-yl)acetate , 97% , 21909-49-9
Synonym(s):
2-Methyl-1H-indole-3-acetic acid ethyl ester;NSC 289352
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB278.40 | In Stock |
|
| 250mg | RMB472.80 | In Stock |
|
| 1g | RMB1275.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 95 °C(Solv: ethyl ether (60-29-7)) |
| Boiling point: | 195-196 °C/3.5 mmHg (lit.) |
| Density | 1.11 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| pka | 17.27±0.30(Predicted) |
| InChI | 1S/C13H15NO2/c1-3-16-13(15)8-11-9(2)14-12-7-5-4-6-10(11)12/h4-7,14H,3,8H2,1-2H3 |
| InChIKey | SLEXJGHKKHQSDC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1c(C)[nH]c2ccccc12 |
Description and Uses
• ;Reactant for preparation of hydroxamate derivatives as HDAC inhibitor with anticancer activity1• ;Reactant for stereoselective preparation of AG-041R, as a Potent Gastrin/CCK-B Receptor Antagonist2
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






