BD0876932
(4-Nitrophenyl)methanamine hydrochloride , 97% , 18600-42-5
CAS NO.：18600-42-5
Empirical Formula: C7H9ClN2O2
Molecular Weight: 188.61
MDL number: MFCD00012863
EINECS: 242-441-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB35.20 | In Stock |
|
| 1g | RMB56.00 | In Stock |
|
| 5g | RMB212.00 | In Stock |
|
| 10g | RMB410.40 | In Stock |
|
| 25g | RMB917.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~265 °C (dec.)(lit.) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | methanol:glacial acetic acid (1:1): soluble25mg/mL, clear, colorless to light yellow |
| form | powder to crystal |
| color | White to Light yellow |
| Water Solubility | almost transparency |
| BRN | 3629994 |
| Stability: | Stable. Incompatible with acids, acid chlorides, acid anhydrides, oxidizing agents. |
| InChI | InChI=1S/C7H8N2O2.ClH/c8-5-6-1-3-7(4-2-6)9(10)11;/h1-4H,5,8H2;1H |
| InChIKey | SMIXZZMSWYOQPW-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)C=CC(CN)=CC=1.Cl |
| CAS DataBase Reference | 18600-42-5(CAS DataBase Reference) |
Description and Uses
4-Nitrobenzylamine hydrochloride was used in chemical modification of graphite powder and multiwalled carbon nanotubes. It was also used in the preparation of 2-fluoro-6-(4-nitrohenzylamino)purine.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | DP6705000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29214990 |
