BD0880132
1-(2-Naphthyl)methanamine , 95% , 2018-90-8
CAS NO.:2018-90-8
Empirical Formula: C11H11N
Molecular Weight: 157.21
MDL number: MFCD01529867
EINECS: 241-580-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB44.80 | In Stock |
|
| 1g | RMB142.40 | In Stock |
|
| 5g | RMB573.60 | In Stock |
|
| 25g | RMB2298.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 59.5°C |
| Boiling point: | 271.88°C (rough estimate) |
| Density | 1.0595 (rough estimate) |
| refractive index | 1.6722 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 9.06±0.30(Predicted) |
| form | solid |
| color | Yellow |
| InChI | InChI=1S/C11H11N/c12-8-9-5-6-10-3-1-2-4-11(10)7-9/h1-7H,8,12H2 |
| InChIKey | XBCAHQUVHHHHHHL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)CN |
Description and Uses
1-(2-Naphthyl)methanamine can be used as organic synthesis intermediates and pharmaceutical intermediates, mainly used in laboratory research and development and chemical production process.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| HS Code | 2921490090 |





![Xylylazo Violet II [Spectrophotometric reagent for Mg]](https://img.chemicalbook.com/CAS/GIF/523-67-1.gif)

