BD0884048
1-(2-(Trifluoromethyl)phenyl)propan-1-one , 97% , 16185-96-9
| Pack Size | Price | Stock | Quantity |
| 5g | RMB182.40 | In Stock |
|
| 10g | RMB227.20 | In Stock |
|
| 25g | RMB552.80 | In Stock |
|
| 100g | RMB2172.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 219-220 °C(lit.) |
| Density | 1.214 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 214 °F |
| storage temp. | Sealed in dry,Room Temperature |
| Specific Gravity | 1.214 |
| Appearance | Colorless to light yellow Liquid |
| BRN | 2263292 |
| InChI | InChI=1S/C10H9F3O/c1-2-9(14)7-5-3-4-6-8(7)10(11,12)13/h3-6H,2H2,1H3 |
| InChIKey | PUSBIOFSWWHNDD-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC=C1C(F)(F)F)(=O)CC |
| CAS DataBase Reference | 16185-96-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-(Trifluoromethyl)propiophenone(16185-96-9) |
Description and Uses
2'-(Trifluoromethyl)propiophenone is a derivative of Tanshinone and can be used in the pharmaceutical and preservative industries. It can also inhibit the formation of hemolytic plaques and enhance the body's antioxidant capacity. Therefore, 2'-(trifluoromethyl)phenylacetone has significant application value in both biological preservation and pharmaceutical fields. Currently, the main methods for synthesizing it are chemical synthesis and biosynthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P304+P340+P312-P305+P351+P338-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29147000 |
| Storage Class | 10 - Combustible liquids |





