BD0890032
4-Chloro-2,6-dimethylaniline , 98% , 24596-18-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB71.20 | In Stock |
|
| 1g | RMB94.40 | In Stock |
|
| 5g | RMB271.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 45-50°C |
| Boiling point: | 260.6±35.0 °C(Predicted) |
| Density | 1.142±0.06 g/cm3(Predicted) |
| pka | 3.67±0.10(Predicted) |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C8H10ClN/c1-5-3-7(9)4-6(2)8(5)10/h3-4H,10H2,1-2H3 |
| InChIKey | JCLZLZKUISPXDC-UHFFFAOYSA-N |
| SMILES | C1(N)=C(C)C=C(Cl)C=C1C |
| CAS DataBase Reference | 24596-18-7(CAS DataBase Reference) |
Description and Uses
4-chloro-2,6-dimethylaniline was chosen as a substrate of medium in palladium-catalyzed cyanations of aryl chlorides.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Warning |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P280a-P301+P310a-P305+P351+P338-P405-P501a |
| Risk Statements | 23/24/25-36/37/38 |
| Safety Statements | 23-36/37/39-45 |
| RIDADR | 2811 |
| HS Code | 2921420090 |
