BD0896732
(2-Nitroethyl)benzene , 95% , 6125-24-2
CAS NO.:6125-24-2
Empirical Formula: C8H9NO2
Molecular Weight: 151.16
MDL number: MFCD00210449
EINECS: 228-094-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB222.40 | In Stock |
|
| 250mg | RMB373.60 | In Stock |
|
| 1g | RMB738.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 56-58℃ |
| Boiling point: | 250℃ |
| Density | 1.122 g/cm3 (25℃) |
| refractive index | 1.5270 (589.3 nm 20℃) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Oil |
| pka | 8.13±0.10(Predicted) |
| color | Colourless |
| Odor | flower spice |
| InChI | InChI=1S/C8H9NO2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | XAWCLWKTUKMCMO-UHFFFAOYSA-N |
| SMILES | C1(CC[N+]([O-])=O)=CC=CC=C1 |
Description and Uses
1-(Phenyl) 2-nitroethane has been mentioned in connection with perfume raw materials, and since it could be made readily available, it has been considered for perfumery purposes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319-H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |






![3-(1-NITRO-2-[4-(TRIFLUOROMETHOXY)ANILINO]VINYL)-2-BENZOFURAN-1(3H)-ONE](https://img.chemicalbook.com/StructureFile/ChemBookStructure2/GIF/CB9467288.gif)
