PRODUCT Properties
| Melting point: | 48-51 °C(lit.) |
| Boiling point: | 169 °C13 mm Hg(lit.) |
| Density | 1.2022 (estimate) |
| refractive index | 1.5310 (estimate) |
| Flash point: | >230 °F |
| form | solid |
| InChI | 1S/C10H13NO4/c1-3-14-8-5-6-10(15-4-2)9(7-8)11(12)13/h5-7H,3-4H2,1-2H3 |
| InChIKey | AUCRWWWSFGZHBK-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(OCC)c(c1)[N+]([O-])=O |
| CAS DataBase Reference | 119-23-3(CAS DataBase Reference) |
| EPA Substance Registry System | Benzene, 1,4-diethoxy-2-nitro- (119-23-3) |
Description and Uses
Reduction of 1,4- diethoxy-2-nitrobenzene, yields 2,5-diethoxyaniline [94-85-9], which is used as an azo coupling component or as the intermediate for Fast Blue BB Base by consecutive benzoylation, nitration, and reduction.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-36 |
| Safety Statements | 26-37/39 |
| WGK Germany | 2 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |
