BD0920653
Tetrabenzyldiphosphate , 99% , 990-91-0
Synonym(s):
Pyrophosphoric acid tetrabenzyl ester;Tetrabenzyl diphosphate
CAS NO.:990-91-0
Empirical Formula: C28H28O7P2
Molecular Weight: 538.47
MDL number: MFCD00051941
EINECS: 628-817-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB53.60 | In Stock |
|
| 25g | RMB166.40 | In Stock |
|
| 100g | RMB569.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 63-66 °C (lit.) |
| Boiling point: | 601.6±55.0 °C(Predicted) |
| Density | 1.289±0.06 g/cm3(Predicted) |
| vapor pressure | 0.001Pa at 140℃ |
| storage temp. | -20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Powder or Crystalline Powder |
| color | White to off-white |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Moisture Sensitive |
| BRN | 2068292 |
| InChI | InChI=1S/C28H28O7P2/c29-36(31-21-25-13-5-1-6-14-25,32-22-26-15-7-2-8-16-26)35-37(30,33-23-27-17-9-3-10-18-27)34-24-28-19-11-4-12-20-28/h1-20H,21-24H2 |
| InChIKey | NSBNXCZCLRBQTA-UHFFFAOYSA-N |
| SMILES | P(=O)(OCC1C=CC=CC=1)(OCC1C=CC=CC=1)OP(=O)(OCC1C=CC=CC=1)OCC1C=CC=CC=1 |
| CAS DataBase Reference | 990-91-0(CAS DataBase Reference) |
Description and Uses
Phosphorylating reagent.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29209090 |
| REACH Registrations | Active |
| Limited Quantities | 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |






