BD0924048
9-((2R,3R,4R,5R)-4-Hydroxy-5-(hydroxymethyl)-3-methoxytetrahydrofuran-2-yl)-9H-purin-6-ol , 99% , 3881-21-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB2145.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 153-156 °C |
| Boiling point: | 724.3±60.0 °C(Predicted) |
| Density | 1.84±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 8.92±0.70(Predicted) |
| form | Powder |
| color | White to Off-white |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C11H14N4O5/c1-19-8-7(17)5(2-16)20-11(8)15-4-14-6-9(15)12-3-13-10(6)18/h3-5,7-8,11,16-17H,2H2,1H3,(H,12,13,18)/t5-,7-,8-,11-/m1/s1 |
| InChIKey | HPHXOIULGYVAKW-IOSLPCCCSA-N |
| SMILES | OC[C@H]1O[C@@H](N2C3C(=C(N=CN=3)O)N=C2)[C@H](OC)[C@@H]1O |
Description and Uses
2’-O-Methylinosine is a novel nucleoside as a constituent of the rRNA of Crithidia fasciculata. Also, it possesses intrinsic hypotensive activity. Apoptosis inducing nucleosides (AINs).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
