BD4200046
(2R,3R,4R,5R)-2-(Acetoxymethyl)-5-(6-oxo-1H-purin-9(6H)-yl)tetrahydrofuran-3,4-diyldiacetate , 97% , 3181-38-2
CAS NO.：3181-38-2
Empirical Formula: C16H18N4O8
Molecular Weight: 394.34
MDL number: MFCD00038617
EINECS: 221-669-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB33.60 | In Stock |
|
| 5g | RMB83.20 | In Stock |
|
| 10g | RMB137.60 | In Stock |
|
| 25g | RMB281.60 | In Stock |
|
| 100g | RMB952.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 234-236°C |
| Boiling point: | 620.7±65.0 °C(Predicted) |
| Density | 1.62±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Methanol (Sparingly), Water (Sparingly) |
| form | Solid |
| pka | 2.96±0.20(Predicted) |
| color | White |
| Stability: | Freezer |
| InChIKey | SFEQTFDQPJQUJM-XNIJJKJLSA-N |
| SMILES | C(OC(=O)C)[C@H]1O[C@@H](N2C3C(=C(N=CN=3)O)N=C2)[C@H](OC(=O)C)[C@@H]1OC(=O)C |
| CAS DataBase Reference | 3181-38-2(CAS DataBase Reference) |
Description and Uses
2',3',5'-Tri-O-acetylinosine has been shown to inhibit the growth of cancer cells, and is also an efficient method for bond cleavage and radiation protection. 2',3',5'-Tri-O-acetylinosine has been shown to bind to pyridinium ions, and it has been used in the synthesis of tetrapeptides with hydroxyl groups or alkylation.
2',3',5'-Tri-O-acetylinosine is an intermediate used for the synthesis of 6-substituted purine ribosides
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29349990 |
