BD0927232
Rubiadin , 98+% , 117-02-2
Synonym(s):
1,3-Dihydroxy-2-methyl-9,10-anthracenedione;1,3-Dihydroxy-2-methylanthraquinone
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB686.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 290℃ |
| Boiling point: | 527.1±30.0 °C(Predicted) |
| Density | 1.476 |
| storage temp. | 2-8°C |
| solubility | DMF: 0.5 mg/ml; DMSO: 0.5 mg/ml |
| Colour Index | 75350 |
| pka | 7.22±0.20(Predicted) |
| form | Solid |
| color | Light yellow to yellow |
| BRN | 1885558 |
| Major Application | food and beverages |
| InChI | 1S/C15H10O4/c1-7-11(16)6-10-12(13(7)17)15(19)9-5-3-2-4-8(9)14(10)18/h2-6,16-17H,1H3 |
| InChIKey | IRZTUXPRIUZXMP-UHFFFAOYSA-N |
| SMILES | O=C1C2=C(C=C(O)C(C)=C2O)C(C3=CC=CC=C31)=O |
| CAS DataBase Reference | 117-02-2 |
Description and Uses
Rubiadin is an anthraquinone that is a minor component of certain Rubia species, as well as other plants. It demonstrates antioxidant activity.
Rubiadin is a dihydroxy anthraquinone isolated from Rubia cordifolia. Rubiadin exhibits anti-epileptic activity in mice.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H351 |
| Precautionary statements | P202-P264-P270-P280-P301+P312-P308+P313 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| HS Code | 29146990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 |







