PRODUCT Properties
| Melting point: | >330℃ |
| Boiling point: | 333.35°C (rough estimate) |
| Density | 1.592±0.06 g/cm3 (20 ºC 760 Torr) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in DMSO |
| form | Solid |
| pka | 6.83±0.20(Predicted) |
| color | Light yellow to yellow |
| Major Application | food and beverages |
| InChI | 1S/C15H10O5/c16-6-10-11(17)5-9-12(15(10)20)14(19)8-4-2-1-3-7(8)13(9)18/h1-5,16-17,20H,6H2 |
| InChIKey | AMIDUPFSOUCLQB-UHFFFAOYSA-N |
| SMILES | OCc1c(c2c(cc1O)C(=O)c3c(cccc3)C2=O)O |
Description and Uses
food and beverages
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H350 |
| Precautionary statements | P201-P202-P264-P270-P280-P301+P312+P330-P308+P313-P405-P501 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 |
| Hazardous Substances Data | 478-08-0(Hazardous Substances Data) |
