BD0935853
Chloranilicacid , 95% , 87-88-7
Synonym(s):
2,5-Dichloro-3,6-dihydroxy-p-benzoquinone;2,5-Dichloro-3,6-dihydroxy-2,5-cyclohexadiene-1,4-dione;NSC 6108;NSC 97383
CAS NO.:87-88-7
Empirical Formula: C6H2Cl2O4
Molecular Weight: 208.98
MDL number: MFCD00001596
EINECS: 201-780-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB72.80 | In Stock |
|
| 25g | RMB212.80 | In Stock |
|
| 100g | RMB594.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ≥300 °C (lit.) |
| Boiling point: | 300.11°C (rough estimate) |
| Density | 1.93 |
| refractive index | 1.4570 (estimate) |
| storage temp. | Amber Vial, Refrigerator |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | pK1:1.09;pK2:2.42 (25°C) |
| form | Fine Powder |
| color | Orange to red |
| Odor | Odorless |
| Water Solubility | Soluble in hot water and methanol. Insoluble in organic solvents. |
| Merck | 14,2079 |
| BRN | 1875040 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C6H2Cl2O4/c7-1-3(9)5(11)2(8)6(12)4(1)10/h9,12H |
| InChIKey | IPPWILKGXFOXHO-UHFFFAOYSA-N |
| SMILES | OC1=C(Cl)C(=O)C(O)=C(Cl)C1=O |
| CAS DataBase Reference | 87-88-7(CAS DataBase Reference) |
| EPA Substance Registry System | 2,5-Cyclohexadiene-1,4-dione, 2,5-dichloro-3,6-dihydroxy- (87-88-7) |
Description and Uses
Reacts with metal cations to form stable salts. Used in spectrophotometry: Hart, organic. Chem. Bull. 33, no. 3 (1961).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | DK4005000 |
| TSCA | TSCA listed |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






