T9065430
Chlorendic Acid , >98.0%(T) , 115-28-6
Synonym(s):
1,2,3,4,7,7-Hexachlorobicyclo[2.2.1]hept-2-ene-5,6-dicarboxylic acid;Hexachloroendomethylenetetrahydrophthalic acid
CAS NO.:115-28-6
Empirical Formula: C9H4Cl6O4
Molecular Weight: 388.84
MDL number: MFCD00167589
EINECS: 204-078-9
| Pack Size | Price | Stock | Quantity |
| 25g | RMB312.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 239-242 °C(lit.) |
| Boiling point: | 175°C (rough estimate) |
| Density | 1.7157 (estimate) |
| storage temp. | Amber Vial, -20°C Freezer |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 1.26±0.70(Predicted) |
| form | Solid |
| color | White to Off-White |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C9H4Cl6O4/c10-3-4(11)8(13)2(6(18)19)1(5(16)17)7(3,12)9(8,14)15/h1-2H,(H,16,17)(H,18,19) |
| InChIKey | DJKGDNKYTKCJKD-UHFFFAOYSA-N |
| SMILES | ClC12C(=C(C(C(C1C(=O)O)C(=O)O)(C2(Cl)Cl)Cl)Cl)Cl |
| CAS DataBase Reference | 115-28-6(CAS DataBase Reference) |
| IARC | 2B (Vol. 48) 1990 |
| NIST Chemistry Reference | Bicyclo[2.2.1]-5-heptene-2,3-dicarboxylic acid, 1,4,5,6,7,7-hexachloro-(115-28-6) |
| EPA Substance Registry System | Chlorendic acid (115-28-6) |
Description and Uses
Hexachlorobicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic Acid is a novel flame retardant (NFR) which has also been observed as a toxic and environmental pollutant. Chlorinated Reactive Flame Retardant IntermediateEnvironmental toxin on US EPA Toxic Release Inventory list (TRI) list.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS08 |
| Signal word | Danger |
| Hazard statements | H318-H351 |
| Precautionary statements | P201-P280-P305+P351+P338+P310-P308+P313 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xi |
| Risk Statements | 40-41 |
| Safety Statements | 53-22-26-36/37/39-45 |
| WGK Germany | 3 |
| RTECS | RB9000000 |
| TSCA | TSCA listed |
| HS Code | 2917.20.0000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Carc. 2 Eye Dam. 1 |
| Hazardous Substances Data | 115-28-6(Hazardous Substances Data) |







