BD0951553
(Methylsulfinyl)benzene , 98% , 1193-82-4
CAS NO.:1193-82-4
Empirical Formula: C7H8OS
Molecular Weight: 140.2
MDL number: MFCD00002088
EINECS: 214-781-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB50.40 | In Stock |
|
| 5g | RMB109.60 | In Stock |
|
| 25g | RMB441.60 | In Stock |
|
| 100g | RMB1438.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 26-29 °C (lit.) |
| Boiling point: | 139-140 °C/14 mmHg (lit.) |
| Density | 1.1182 (rough estimate) |
| refractive index | n |
| Flash point: | 187 °F |
| storage temp. | 2-8°C |
| form | Crystalline Low Melting Mass |
| color | White |
| Sensitive | Hygroscopic |
| BRN | 1904976 |
| InChI | InChI=1S/C7H8OS/c1-9(8)7-5-3-2-4-6-7/h2-6H,1H3 |
| InChIKey | JXTGICXCHWMCPM-UHFFFAOYSA-N |
| SMILES | C1(S(C)=O)=CC=CC=C1 |
| CAS DataBase Reference | 1193-82-4(CAS DataBase Reference) |
Description and Uses
Methyl phenyl sulfoxide has been used in the synthesis of:
- isotopically labelled 1, 3-dithiane, a useful labeled synthon
- nelfinavir, potent HIV-protease inhibitor
- sulfoximines and in studies on solvent-water partitioning
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 37/38-41 |
| Safety Statements | 22-24/25-39-26 |
| WGK Germany | 3 |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |








