![2-(Trifluoromethyl)-1H-benzo[d]imidazole](https://img.chemicalbook.com/CAS/GIF/312-73-2.gif)
BD0968832
2-(Trifluoromethyl)-1H-benzo[d]imidazole , 95% , 312-73-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB95.20 | In Stock |
|
| 10g | RMB169.60 | In Stock |
|
| 25g | RMB392.00 | In Stock |
|
| 100g | RMB1533.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 208-211 °C(lit.) |
| Boiling point: | 262.8±40.0 °C(Predicted) |
| Density | 1.3658 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 9.25±0.10(Predicted) |
| Appearance | Light brown to off-white Solid |
| Water Solubility | PRACTICALLY INSOLUBLE |
| InChI | InChI=1S/C8H5F3N2/c9-8(10,11)7-12-5-3-1-2-4-6(5)13-7/h1-4H,(H,12,13) |
| InChIKey | MXFMPTXDHSDMTI-UHFFFAOYSA-N |
| SMILES | C1(C(F)(F)F)NC2=CC=CC=C2N=1 |
| CAS DataBase Reference | 312-73-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Trifluoromethylbenzimidazole(312-73-2) |
Description and Uses
Agricultural chemical.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | T,Xi |
| Risk Statements | 23/24/25-36/37/38 |
| Safety Statements | 22-26-36/37/39-45-28A |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | DE1576000 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29332900 |
![5-Nitro-2-(trifluoromethyl)-1H-benzo[d]imidazole](https://img.chemicalbook.com/CAS/GIF/327-19-5.gif)
